| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:34 UTC |
|---|
| Update Date | 2025-03-21 18:34:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101901 |
|---|
| Frequency | 26.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H9FO4 |
|---|
| Molecular Mass | 272.0485 |
|---|
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)c(F)cc12 |
|---|
| InChI Key | GFLCTINOSDHTOR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl fluoridesbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidso-fluorophenolsorganic oxidesorganofluoridesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | aryl fluoridemonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundisoflavonebenzopyranorganofluorideheteroaromatic compound2-fluorophenolaryl halideoxacycleorganic oxygen compoundpyranphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|