| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:35 UTC |
|---|
| Update Date | 2025-03-21 18:34:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101941 |
|---|
| Frequency | 26.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C2H2Cl3O5P |
|---|
| Molecular Mass | 241.8705 |
|---|
| SMILES | O=C(OP(=O)(O)O)C(Cl)(Cl)Cl |
|---|
| InChI Key | ZEYNKQAERAVWCV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | acyl monophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chloridesalpha-halocarboxylic acid derivativescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganochlorides |
|---|
| Substituents | alpha-halocarboxylic acid or derivativesaliphatic acyclic compoundcarbonyl groupalkyl chlorideorganochlorideacyl monophosphatecarboxylic acid derivativeorganohalogen compoundalpha-halocarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
