| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:36 UTC |
|---|
| Update Date | 2025-03-21 18:34:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101993 |
|---|
| Frequency | 26.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H20N2O3 |
|---|
| Molecular Mass | 216.1474 |
|---|
| SMILES | CCC(C)C(N)C(=O)N1CC(O)C(O)C1 |
|---|
| InChI Key | LQRWEEFULWZSRQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | isoleucine and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acid amidesalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesn-acylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | carbonyl groupn-acylpyrrolidineorganic oxidetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineisoleucine or derivativesorganoheterocyclic compound1,2-diolalcoholalpha-amino acid amideazacyclecarboxamide grouporganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|