| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:38 UTC |
|---|
| Update Date | 2025-03-21 18:34:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102085 |
|---|
| Frequency | 26.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16N2O3 |
|---|
| Molecular Mass | 272.1161 |
|---|
| SMILES | COc1cc(CNC(=O)c2ccc(N)cc2)ccc1O |
|---|
| InChI Key | OYSQPKIACYWEFM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | n-benzylbenzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersamino acids and derivativesanisolesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesorganopnictogen compoundsphenoxy compoundsprimary aminessecondary carboxylic acid amides |
|---|
| Substituents | phenol etheretheramino acid or derivativesbenzoyl1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl ethercarboxylic acid derivativeorganic oxiden-benzylbenzamideorganonitrogen compoundorganopnictogen compoundcarboxamide groupmethoxybenzenearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundanisolephenolhydrocarbon derivativeprimary amineorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
