Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-21 00:16:38 UTC |
---|
Update Date | 2025-03-21 18:34:43 UTC |
---|
HMDB ID | HMDB0249071 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00102091 |
---|
Name | Benzyl DL-mandelate |
---|
Frequency | 26.7 |
---|
Structure | |
---|
Chemical Formula | C15H14O3 |
---|
Molecular Mass | 242.0943 |
---|
SMILES | O=C(OCc1ccccc1)C(O)c1ccccc1 |
---|
InChI Key | JFKWZVQEMSKSBU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzyloxycarbonyls |
---|
Direct Parent | benzyloxycarbonyls |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | aromatic alcoholscarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
---|
Substituents | benzyloxycarbonylaromatic alcoholalcoholcarbonyl groupcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
---|