| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:16:38 UTC |
|---|
| Update Date | 2025-03-21 18:34:43 UTC |
|---|
| HMDB ID | HMDB0249071 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102091 |
|---|
| Name | Benzyl DL-mandelate |
|---|
| Frequency | 26.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O3 |
|---|
| Molecular Mass | 242.0943 |
|---|
| SMILES | O=C(OCc1ccccc1)C(O)c1ccccc1 |
|---|
| InChI Key | JFKWZVQEMSKSBU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholscarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | benzyloxycarbonylaromatic alcoholalcoholcarbonyl groupcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
