| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:38 UTC |
|---|
| Update Date | 2025-03-21 18:34:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102098 |
|---|
| Frequency | 26.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N4O7 |
|---|
| Molecular Mass | 288.0706 |
|---|
| SMILES | O=CNc1nc(=O)n(C2OC(CO)C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | SCLJYRKHMCFQLE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | n-arylamides |
|---|
| Direct Parent | n-arylamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshalo-s-triazinesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesn-aliphatic s-triazinesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amidestetrahydrofuranstriazinones |
|---|
| Substituents | n-aliphatic s-triazinecarbonyl groupamino-1,3,5-triazinearomatic heteromonocyclic compoundmonosacchariden-arylamidecarboxylic acid derivativesaccharideorganic oxideorganopnictogen compoundprimary alcoholorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundhalo-s-triazinesecondary alcoholtriazinehydrocarbon derivative1,3,5-triazinetriazinoneorganooxygen compound |
|---|
