| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:39 UTC |
|---|
| Update Date | 2025-03-21 18:34:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102111 |
|---|
| Frequency | 26.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O7 |
|---|
| Molecular Mass | 298.1053 |
|---|
| SMILES | O=C(Cc1ccccc1)OC1C(O)C(O)C(O)C(O)C1O |
|---|
| InChI Key | SSXRGQWBBNBJEK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboxylic acid esterscyclitols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcyclohexanolcyclitol or derivativescyclic alcoholcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativescarboxylic acid esterhydrocarbon derivativebenzenoid |
|---|