| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:39 UTC |
|---|
| Update Date | 2025-03-21 18:34:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102114 |
|---|
| Frequency | 26.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13O10P |
|---|
| Molecular Mass | 288.0246 |
|---|
| SMILES | O=C(O)C1(O)CC(OP(=O)(O)O)C(O)C(O)C1O |
|---|
| InChI Key | SYMOIGCYLAACQQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclohexanolshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidcyclohexanolhydroxy acidcarboxylic acid derivativebeta-hydroxy acidtertiary alcoholorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphatequinic acid |
|---|