| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:42 UTC |
|---|
| Update Date | 2025-03-21 18:34:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102238 |
|---|
| Frequency | 26.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O5S2 |
|---|
| Molecular Mass | 249.997 |
|---|
| SMILES | O=C(CCCc1cccs1)OS(=O)(=O)O |
|---|
| InChI Key | WTDHBALDNFPWQJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesthiophenes |
|---|
| Substituents | sulfuric acid monoestercarbonyl grouparomatic heteromonocyclic compoundheteroaromatic compoundthiophenecarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
