| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:46 UTC |
|---|
| Update Date | 2025-03-21 18:34:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102399 |
|---|
| Frequency | 26.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H16NO4+ |
|---|
| Molecular Mass | 178.1074 |
|---|
| SMILES | C[N+](C)(C)C(C(=O)O)C(O)CO |
|---|
| InChI Key | NZNYOUWPVYQZKF-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,3-aminoalcoholsaminesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscholineshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsprimary alcoholssecondary alcoholsshort-chain hydroxy acids and derivativestetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidfatty acidbeta-hydroxy acidorganic oxidealpha-amino acidorganonitrogen compoundorganopnictogen compoundhydroxy fatty acidorganic cationorganic saltprimary alcohol1,2-diolalcohol1,3-aminoalcoholtetraalkylammonium saltquaternary ammonium salthydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundcholinesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
