| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:48 UTC |
|---|
| Update Date | 2025-03-21 18:34:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102490 |
|---|
| Frequency | 26.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16N4O3 |
|---|
| Molecular Mass | 276.1222 |
|---|
| SMILES | O=C1NC(Cc2cnc[nH]2)C(=O)N2CCCCC2C1=O |
|---|
| InChI Key | ZCCBGJHKRGDVMI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-diazepanesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesketoneslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinessecondary carboxylic acid amidestertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactam1,4-diazepanediazepaneketoneorganic oxidearomatic heteropolycyclic compoundimidazoletertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpiperidineorganoheterocyclic compoundazoleazacycleheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
