Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:16:52 UTC |
---|
Update Date | 2025-03-21 18:34:51 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00102673 |
---|
Frequency | 26.5 |
---|
Structure | |
---|
Chemical Formula | C13H12N2O5S |
---|
Molecular Mass | 308.0467 |
---|
SMILES | Nc1ccc(C(=O)Nc2ccc(OS(=O)(=O)O)cc2)cc1 |
---|
InChI Key | AQAURXNMJBYYQC-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | anilides |
---|
Direct Parent | benzanilides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | amino acids and derivativesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenoxy compoundsphenylsulfatesprimary aminessecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoesterbenzanilideamino acid or derivativesbenzoylcarboxylic acid derivativebenzamidephenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundarylsulfateorganic sulfuric acid or derivativesbenzoic acid or derivativescarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundsulfate-esterhydrocarbon derivativeprimary amineorganic nitrogen compoundphenoxy compoundsulfuric acid esteramineorganooxygen compound |
---|