| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:54 UTC |
|---|
| Update Date | 2025-03-21 18:34:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102759 |
|---|
| Frequency | 26.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H20N4O6 |
|---|
| Molecular Mass | 304.1383 |
|---|
| SMILES | N=C(N)NCCCC(NC(CCC(=O)O)C(=O)O)C(=O)O |
|---|
| InChI Key | LMKYZBGVKHTLTN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | arginine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidscarbonyl compoundscarboximidamidescarboxylic acidsdialkylaminesglutamic acid and derivativesguanidineshydrocarbon derivativesiminesorganic oxidesorganopnictogen compoundstricarboxylic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidamino acidguanidineiminetricarboxylic acid or derivativesorganic oxidearginine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundsecondary aliphatic amineglutamic acid or derivativescarboximidamidesecondary amineorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
