| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:16:59 UTC |
|---|
| Update Date | 2025-03-21 18:34:55 UTC |
|---|
| HMDB ID | HMDB0245063 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00102957 |
|---|
| Name | 2-Chloroadenosine |
|---|
| Frequency | 26.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12ClN5O4 |
|---|
| Molecular Mass | 301.0578 |
|---|
| SMILES | Nc1nc(Cl)nc2c1ncn2C1OC(CO)C(O)C1O |
|---|
| InChI Key | BIXYYZIIJIXVFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyrimidinesaryl chloridesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganochloridesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | 2-halopyrimidineorganochloridemonosaccharideimidazopyrimidineorganohalogen compoundpyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compoundazolen-substituted imidazolearyl chloridealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundhalopyrimidinearyl halideoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
