Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:16:59 UTC |
---|
Update Date | 2025-03-21 18:34:55 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00102965 |
---|
Frequency | 26.4 |
---|
Structure | |
---|
Chemical Formula | C10H11NO7S |
---|
Molecular Mass | 289.0256 |
---|
SMILES | O=CNC(Cc1ccc(OS(=O)(=O)O)cc1)C(=O)O |
---|
InChI Key | FZQDTUYHEHPLJP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | phenylalanine and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsamphetamines and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-formyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsphenylpropanoic acidsphenylsulfatessecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl groupcarboxylic acid3-phenylpropanoic-acidphenylsulfateorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-formyl-alpha amino acid or derivativesarylsulfateamphetamine or derivativesorganic sulfuric acid or derivativescarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesn-formyl-alpha-amino acidorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
---|