| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:01 UTC |
|---|
| Update Date | 2025-03-21 18:34:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103037 |
|---|
| Frequency | 26.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7O6S+ |
|---|
| Molecular Mass | 242.9958 |
|---|
| SMILES | O=S(O)c1cc(O)[o+]c2cc(O)cc(O)c12 |
|---|
| InChI Key | AKLMBVCDHSBCTI-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzenoidsheteroaromatic compoundshydrocarbon derivativesorganic cationsorganic oxidesorganooxygen compoundsorganosulfur compoundsoxacyclic compoundssulfinic acids |
|---|
| Substituents | benzopyran1-benzopyransulfinic acid derivativeheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidorganosulfur compoundcoumarinsulfinic acidoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundhydrocarbon derivativebenzenoidorganic cationorganoheterocyclic compoundorganooxygen compound |
|---|
