| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:04 UTC |
|---|
| Update Date | 2025-03-21 18:34:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103144 |
|---|
| Frequency | 26.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H9O8P |
|---|
| Molecular Mass | 216.0035 |
|---|
| SMILES | O=C(O)C(CO)(CO)OP(=O)(O)O |
|---|
| InChI Key | SABTVZRKFOFDBY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerophospholipids |
|---|
| Subclass | glycerophosphates |
|---|
| Direct Parent | glycerophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidhydroxy acidcarboxylic acid derivativebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativesn-glycerol-2-phosphateorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
