| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:17:07 UTC |
|---|
| Update Date | 2025-03-21 18:34:59 UTC |
|---|
| HMDB ID | HMDB0301830 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103300 |
|---|
| Name | 2-Carboxyarabinitol 1-phosphate |
|---|
| Frequency | 26.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O10P |
|---|
| Molecular Mass | 276.0246 |
|---|
| SMILES | O=C(O)C(O)(COP(=O)(O)O)C(O)C(O)CO |
|---|
| InChI Key | UJTMIRNFEXKGMS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsfatty acids and conjugateshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcoholsshort-chain hydroxy acids and derivativestertiary alcohols |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidalpha-hydroxy acidmonosaccharidefatty acidcarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxideprimary alcoholalcoholtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
