| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:07 UTC |
|---|
| Update Date | 2025-03-21 18:34:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103301 |
|---|
| Frequency | 26.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N2O6 |
|---|
| Molecular Mass | 246.0852 |
|---|
| SMILES | O=C(O)C(CO)NC(=O)N1CCCC1C(=O)O |
|---|
| InChI Key | RMJKAAYHUQZCHS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-carbamoyl-alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholsproline and derivativespyrrolidine carboxylic acidspyrrolidinecarboxamidesserine and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidbeta-hydroxy acidorganic oxidepyrrolidine carboxylic acidaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineprimary alcoholorganoheterocyclic compoundproline or derivativesalcoholcarbonic acid derivativeazacyclen-carbamoyl-alpha-amino acidhydroxy acidpyrrolidine carboxylic acid or derivativesorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundserine or derivativesorganooxygen compoundpyrrolidine-1-carboxamide |
|---|
