| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:17:11 UTC |
|---|
| Update Date | 2025-03-21 18:35:00 UTC |
|---|
| HMDB ID | HMDB0030753 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103434 |
|---|
| Name | Aflatoxin Q1 |
|---|
| Frequency | 26.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H12O7 |
|---|
| Molecular Mass | 328.0583 |
|---|
| SMILES | COc1cc2c(c3oc(=O)c4c(c13)C(O)CC4=O)C1C=COC1O2 |
|---|
| InChI Key | GYNOTJLCULOEIM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | furanocoumarins |
|---|
| Direct Parent | difurocoumarocyclopentenones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransacetalsalkyl aryl ethersangular furanocoumarinsanisolesaryl alkyl ketonescoumaransdihydrofuransheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundspyranones and derivativessecondary alcohols |
|---|
| Substituents | difurocoumarocyclopentenonephenol etheretheraryl alkyl ketone1-benzopyranalkyl aryl etherketonelactoneorganic oxideacetalaromatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundcoumarandihydrofuranalcoholbenzopyranheteroaromatic compoundoxacycleorganic oxygen compoundpyrananisolesecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
