| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:11 UTC |
|---|
| Update Date | 2025-03-21 18:35:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103448 |
|---|
| Frequency | 26.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12NO7P |
|---|
| Molecular Mass | 289.0351 |
|---|
| SMILES | O=c1ccccn1C1OC(CO)C2OP(=O)(O)OC21 |
|---|
| InChI Key | WEFQFHWXADFHIE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | ribonucleoside 3'-phosphates |
|---|
| Subclass | ribonucleoside 3'-phosphates |
|---|
| Direct Parent | ribonucleoside 3'-phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativeshydroxypyridineslactamsorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyridinonestetrahydrofurans |
|---|
| Substituents | ribonucleoside 3'-phosphatealcohollactamazacycletetrahydrofuranheteroaromatic compoundhydroxypyridine1,3_dioxaphospholaneoxacycleorganic oxidepyridineorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholpyridinoneorganic phosphoric acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
