| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:12 UTC |
|---|
| Update Date | 2025-03-21 18:35:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103489 |
|---|
| Frequency | 26.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13O9P |
|---|
| Molecular Mass | 284.0297 |
|---|
| SMILES | O=C(O)C1=C(COP(=O)(O)O)C(O)C(O)C(O)C1 |
|---|
| InChI Key | RZEVSBGNGNUQFJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | shikimic acids and derivatves |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidcarboxylic acid derivativeshikimic acid or derivativesorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
