| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:14 UTC |
|---|
| Update Date | 2025-03-21 18:35:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103567 |
|---|
| Frequency | 31.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10N6O2 |
|---|
| Molecular Mass | 270.0865 |
|---|
| SMILES | Nc1nc2nc(N)c(-c3ccc(O)cc3)nc2c(=O)[nH]1 |
|---|
| InChI Key | UAQZCWMZSUQSMQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidones |
|---|
| Substituents | monocyclic benzene moietylactam1-hydroxy-2-unsubstituted benzenoidpyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactampterinazacycleheteroaromatic compoundorganic oxygen compoundpyrazinephenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
