| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:14 UTC |
|---|
| Update Date | 2025-03-21 18:35:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103571 |
|---|
| Frequency | 26.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O4 |
|---|
| Molecular Mass | 268.0736 |
|---|
| SMILES | COc1ccc2oc(-c3ccc(O)cc3)cc(=O)c2c1 |
|---|
| InChI Key | IGELAJYEOYKEOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 6-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran6-methoxyflavonoid-skeleton1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compoundoxacycleorganic oxygen compoundpyrananisole4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
