| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:16 UTC |
|---|
| Update Date | 2025-03-21 18:35:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103636 |
|---|
| Frequency | 26.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H25N3O2 |
|---|
| Molecular Mass | 303.1947 |
|---|
| SMILES | OCCOCCN1CCN(Cc2c[nH]c3ccccc23)CC1 |
|---|
| InChI Key | NJQSAZGBCTWQMA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsaralkylaminesazacyclic compoundsbenzenoidsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesn-alkylpiperazinesorganopnictogen compoundspyrrolestrialkylamines |
|---|
| Substituents | etherindoledialkyl etheraralkylaminepiperazinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtertiary aminealcoholazacyclen-alkylpiperazineheteroaromatic compoundtertiary aliphatic amineorganic oxygen compound1,4-diazinanepyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
