| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:17 UTC |
|---|
| Update Date | 2025-03-21 18:35:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103694 |
|---|
| Frequency | 26.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13ClN4O4 |
|---|
| Molecular Mass | 276.0625 |
|---|
| SMILES | NC(=O)c1ncn(C2OC(CO)C(Cl)C2O)c1N |
|---|
| InChI Key | AJADYGONDBIAPE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acid derivatives |
|---|
| Direct Parent | 2-heteroaryl carboxamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl chloridesamino acids and derivativesazacyclic compoundscarbonyl compoundscarbonylimidazolescarboxylic acids and derivativeschlorohydrinsheteroaromatic compoundshydrocarbon derivativesimidazolesn-substituted imidazolesorganic oxidesorganochloridesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminesprimary carboxylic acid amidessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupchlorohydrinaromatic heteromonocyclic compoundamino acid or derivativesalkyl chlorideorganochlorideorganohalogen compound2-heteroaryl carboxamideorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundalkyl halideimidazole-4-carbonyl groupprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycletetrahydrofuranhalohydrinheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
