| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:21 UTC |
|---|
| Update Date | 2025-03-21 18:35:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00103868 |
|---|
| Frequency | 26.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H34O5 |
|---|
| Molecular Mass | 366.2406 |
|---|
| SMILES | CC12CCC(O)CC1CCC1C2C(O)CC2(C)C1CCC2(O)CC(=O)O |
|---|
| InChI Key | PJXNTAOXUPCBOV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | pregnane steroids |
|---|
| Direct Parent | gluco/mineralocorticoids, progestogins and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroids17-hydroxysteroids3-hydroxysteroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acid3-hydroxysteroidhydroxysteroidcyclic alcoholcarboxylic acid derivativealiphatic homopolycyclic compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivative11-hydroxysteroidprogestogin-skeletonorganooxygen compound17-hydroxysteroid |
|---|
