| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:26 UTC |
|---|
| Update Date | 2025-03-21 18:35:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00104065 |
|---|
| Frequency | 26.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8NO3P |
|---|
| Molecular Mass | 197.0242 |
|---|
| SMILES | O=P(O)(O)c1c[nH]c2ccccc12 |
|---|
| InChI Key | LJHLQDISQNJMFO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganonitrogen compoundsorganophosphorus compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | azacycleindoleheteroaromatic compoundorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganophosphonic acid derivative |
|---|
