| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:27 UTC |
|---|
| Update Date | 2025-03-21 18:35:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00104082 |
|---|
| Frequency | 26.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15I4NO3 |
|---|
| Molecular Mass | 776.7231 |
|---|
| SMILES | CC(O)C(N)Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
|---|
| InChI Key | GXOQSFRVGGNBIJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amphetamines and derivativesaryl iodidesdiarylethershalophenolshydrocarbon derivativesiodobenzenesmonoalkylamineso-iodophenolsorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundssecondary alcohols |
|---|
| Substituents | diaryl etherphenol etheretherorganohalogen compoundiodobenzeneorganoiodideorganonitrogen compoundorganopnictogen compoundamphetamine or derivativesalcohol2-iodophenolaryl halidearomatic homomonocyclic compound2-halophenolorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativeprimary aliphatic aminearyl iodideorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
