| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:28 UTC |
|---|
| Update Date | 2025-03-21 18:35:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00104130 |
|---|
| Frequency | 26.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13NO6S2 |
|---|
| Molecular Mass | 379.0184 |
|---|
| SMILES | O=S(=O)(O)c1ccccc1Nc1cccc2cccc(S(=O)(=O)O)c12 |
|---|
| InChI Key | KZTCYQYBNXBQNR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-naphthalene sulfonates1-sulfo,2-unsubstituted aromatic compoundsarylsulfonic acids and derivativesbenzenesulfonic acids and derivativesbenzenesulfonyl compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acidssecondary aminessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietyorganosulfonic acidbenzenesulfonateorganosulfur compound1-naphthalene sulfonic acid or derivatives1-naphthalene sulfonateorganic oxideorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl group1-sulfo,2-unsubstituted aromatic compoundaromatic homopolycyclic compoundsecondary aminesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativesnaphthalene sulfonatehydrocarbon derivativeorganic nitrogen compoundamine |
|---|
