| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:32 UTC |
|---|
| Update Date | 2025-03-21 18:35:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00104321 |
|---|
| Frequency | 26.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16N2O2 |
|---|
| Molecular Mass | 268.1212 |
|---|
| SMILES | CN1CC(c2ccccc2)(c2ccc(O)cc2)N=C1O |
|---|
| InChI Key | OPMVCNZPMKIHFK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundscarbonyl compoundshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylimidazolidines |
|---|
| Substituents | imidazolidinediphenylmethanecarbonyl groupcarbonic acid derivativephenylimidazolidinearomatic heteromonocyclic compoundazacycle1-hydroxy-2-unsubstituted benzenoidimidazolidinoneorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
