| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:34 UTC |
|---|
| Update Date | 2025-03-21 18:35:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00104387 |
|---|
| Frequency | 26.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9N3O3 |
|---|
| Molecular Mass | 219.0644 |
|---|
| SMILES | O=C1CCN(C(=O)c2cccnc2)C(=O)N1 |
|---|
| InChI Key | SIFNOMLWGCKLFN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | pyridinecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdiazinanesdicarboximidesheteroaromatic compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrimidones |
|---|
| Substituents | pyridine carboxylic acid or derivativescarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidonecarboxylic acid derivativepyrimidine1,3-diazinaneorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativedicarboximideorganic nitrogen compoundorganooxygen compound |
|---|
