Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-21 00:17:34 UTC |
---|
Update Date | 2025-03-21 18:35:11 UTC |
---|
HMDB ID | HMDB0094646 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00104400 |
---|
Name | 2-Pentanamido-3-phenylpropanoic acid |
---|
Frequency | 26.0 |
---|
Structure | |
---|
Chemical Formula | C14H19NO3 |
---|
Molecular Mass | 249.1365 |
---|
SMILES | CCCCC(O)=NC(Cc1ccccc1)C(=O)O |
---|
InChI Key | YXQLJEQFZUMUPB-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | phenylalanine and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboximidic acidscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylpropanoic acidspropargyl-type 1,3-dipolar organic compounds |
---|
Substituents | carboximidic acidmonocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidorganic 1,3-dipolar compoundpropargyl-type 1,3-dipolar organic compoundaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamphetamine or derivatives |
---|