| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:38 UTC |
|---|
| Update Date | 2025-03-21 18:35:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00104533 |
|---|
| Frequency | 25.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O8P |
|---|
| Molecular Mass | 244.0348 |
|---|
| SMILES | O=[PH](O)OC1C(O)C(O)C(O)C(O)C1O |
|---|
| InChI Key | RZLISDJKQIPSBD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativeshydrocarbon derivativesorganic oxidesphosphate esters |
|---|
| Substituents | cyclohexanolcyclitol or derivativescyclic alcoholorganic oxidephosphoric acid esteraliphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivative |
|---|
