| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:17:40 UTC |
|---|
| Update Date | 2025-03-21 18:35:14 UTC |
|---|
| HMDB ID | HMDB0059593 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00104625 |
|---|
| Name | 2-hydroxy-dATP |
|---|
| Frequency | 32.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N5O13P3 |
|---|
| Molecular Mass | 506.9957 |
|---|
| SMILES | Nc1nc(O)nc2c1ncn2C1CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
|---|
| InChI Key | UOACBPRDWRDEHJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesimidolactamsmonoalkyl phosphatesmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | pentose phosphatehydroxypyrimidineimidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphate |
|---|