| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:47 UTC |
|---|
| Update Date | 2025-03-21 18:35:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00104902 |
|---|
| Frequency | 25.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10NO6P |
|---|
| Molecular Mass | 211.0246 |
|---|
| SMILES | CC(=O)NC(C)C(=O)OP(=O)(O)O |
|---|
| InChI Key | NJKSCCSHERHVJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-acyl-alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acetamidesacyl monophosphatesalanine and derivativesalpha amino acidscarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminessecondary carboxylic acid amides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupn-acyl-alpha-amino acidacyl monophosphatecarboxamide groupsecondary carboxylic acid amidephosphoethanolamineorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundalanine or derivativeshydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeacetamideorganooxygen compoundacyl phosphate |
|---|
