| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:51 UTC |
|---|
| Update Date | 2025-03-21 18:35:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105086 |
|---|
| Frequency | 25.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H5FO6 |
|---|
| Molecular Mass | 180.007 |
|---|
| SMILES | O=C(O)CC(F)(C(=O)O)C(=O)O |
|---|
| InChI Key | ZCPBSWZTITUKTJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-halocarboxylic acidscarbonyl compoundscarboxylic acidsfatty acylshalogenated fatty acidshydrocarbon derivativesorganic oxidesorganofluorides |
|---|
| Substituents | halogenated fatty acidalpha-halocarboxylic acid or derivativesfatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidalkyl fluorideorganofluoridetricarboxylic acid or derivativesalpha-halocarboxylic acidorganohalogen compoundorganic oxideorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
