| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:51 UTC |
|---|
| Update Date | 2025-03-21 18:35:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105087 |
|---|
| Frequency | 25.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21N5O5 |
|---|
| Molecular Mass | 387.1543 |
|---|
| SMILES | COc1ccc(CNc2ncnc3c2ncn3C2OC(CO)C(O)C2O)cc1 |
|---|
| InChI Key | LZNPQLJNXKVMMY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmethoxybenzenesmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundsprimary alcoholspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary alkylarylaminestetrahydrofurans |
|---|
| Substituents | phenol ethermonocyclic benzene moietyethermonosaccharideimidazopyrimidinealkyl aryl etherpyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundsecondary aminemethoxybenzenesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativebenzenoidpurineorganic nitrogen compoundphenoxy compoundorganooxygen compoundamine |
|---|
