| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:52 UTC |
|---|
| Update Date | 2025-03-21 18:35:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105104 |
|---|
| Frequency | 60.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N4O11P2 |
|---|
| Molecular Mass | 428.0134 |
|---|
| SMILES | O=P(O)(O)OP(=O)(O)OCC1OC(n2cnc3ncnc(O)c32)C(O)C1O |
|---|
| InChI Key | FPIWGGLVTXVJPA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | nucleoside and nucleotide analogues |
|---|
| Direct Parent | nucleoside and nucleotide analogues |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesmonoalkyl phosphatesmonosaccharidesn-substituted imidazolesorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatespurine 2',3'-dideoxyribonucleoside diphosphatespurine 2'-deoxyribonucleoside diphosphatespurine 3'-deoxyribonucleoside diphosphatespurine nucleosidespurine ribonucleoside diphosphatespurines and purine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | pentose phosphatemonosaccharidepentose-5-phosphatehydroxypyrimidineimidazopyrimidinepurine 2',3'-dideoxyribonucleoside diphosphatepyrimidinesaccharideorganic oxidepurine ribonucleoside diphosphatearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundpurine 3'-deoxyribonucleoside diphosphatepurine 2'-deoxyribonucleoside diphosphateorganic pyrophosphateoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativepurineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
