| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:17:52 UTC |
|---|
| Update Date | 2025-03-21 18:35:20 UTC |
|---|
| HMDB ID | HMDB0130163 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105121 |
|---|
| Name | 3,5-dihydroxy-4-(sulfooxy)cyclohex-1-ene-1-carboxylic acid |
|---|
| Frequency | 25.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O8S |
|---|
| Molecular Mass | 254.0096 |
|---|
| SMILES | O=C(O)C1=CC(O)C(OS(=O)(=O)O)C(O)C1 |
|---|
| InChI Key | LFGSLVFHHHMIPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescarbonyl compoundscarboxylic acidscyclitols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholsulfuric acid monoestercarbonyl groupcarboxylic acidcyclitol or derivativescarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl sulfatesecondary alcoholaliphatic homomonocyclic compoundsulfate-esterhydrocarbon derivativeorganooxygen compound |
|---|
