| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:53 UTC |
|---|
| Update Date | 2025-03-21 18:35:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105171 |
|---|
| Frequency | 39.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N2O8P |
|---|
| Molecular Mass | 322.0566 |
|---|
| SMILES | O=c1ccn(C2OC(CO)C(CP(=O)(O)O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | ABFBHVGRGAUTKZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganonitrogen compoundsorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | alcoholvinylogous amidecarbonic acid derivativelactamaromatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundpyrimidoneoxacycleorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganophosphonic acid derivativeorganooxygen compound |
|---|
