| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:17:53 UTC |
|---|
| Update Date | 2025-03-21 18:35:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105174 |
|---|
| Frequency | 25.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O4 |
|---|
| Molecular Mass | 336.1362 |
|---|
| SMILES | COc1ccc(C=CC(=O)CC(=O)C=Cc2ccc(OC)cc2)cc1 |
|---|
| InChI Key | JFOLIEXFFOBCSM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | curcuminoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsalkyl aryl ethersanisolescinnamic acids and derivativesenoneshydrocarbon derivativesketonesmethoxybenzenesorganic oxidesphenoxy compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetherdesmethoxycurcuminalkyl aryl etheralpha,beta-unsaturated ketonemethoxybenzeneketonearomatic homomonocyclic compoundcinnamic acid or derivativesorganic oxideorganic oxygen compoundanisolehydrocarbon derivativebenzenoidacryloyl-groupphenoxy compoundbis-desmethoxycurcuminorganooxygen compoundenone |
|---|
