| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:00 UTC |
|---|
| Update Date | 2025-03-21 18:35:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105447 |
|---|
| Frequency | 25.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H7FO3 |
|---|
| Molecular Mass | 206.0379 |
|---|
| SMILES | O=C(O)c1ccc(-c2ccc(F)cc2)o1 |
|---|
| InChI Key | CEPXYOAURAQQGM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl fluoridescarboxylic acidsfluorobenzenesheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | aryl fluoridemonocyclic benzene moietycarboxylic acidaromatic heteromonocyclic compoundorganofluorideheteroaromatic compoundcarboxylic acid derivativeorganohalogen compoundfuroic acidaryl halideoxacyclefluorobenzeneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidhalobenzeneorganooxygen compound |
|---|
