| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:10 UTC |
|---|
| Update Date | 2025-03-21 18:35:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105825 |
|---|
| Frequency | 31.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15N3O9P2S |
|---|
| Molecular Mass | 403.0004 |
|---|
| SMILES | Nc1ccn(C2CC(O)C(COP(O)(=S)OP(=O)(O)O)O2)c(=O)n1 |
|---|
| InChI Key | JWNNFKUGWWSMFX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidonessecondary alcoholstetrahydrofuransthiophosphoric acid esters |
|---|
| Substituents | aromatic heteromonocyclic compoundthiophosphoric acid estermonosaccharidepyrimidonepyrimidineorganic thiophosphoric acid or derivativessaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundpyrimidine nucleosideimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|
