| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:10 UTC |
|---|
| Update Date | 2025-03-21 18:35:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105835 |
|---|
| Frequency | 43.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7N7O |
|---|
| Molecular Mass | 193.0712 |
|---|
| SMILES | Nc1nc2nc(N)c(N)nc2c(=O)[nH]1 |
|---|
| InChI Key | FVQVNAHXMIBCSZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidones |
|---|
| Substituents | pterinlactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound |
|---|
