| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:11 UTC |
|---|
| Update Date | 2025-03-21 18:35:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00105891 |
|---|
| Frequency | 67.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10N4O4 |
|---|
| Molecular Mass | 238.0702 |
|---|
| SMILES | O=c1[nH]cnc2c1ncn2C1OC(CO)C1O |
|---|
| InChI Key | UMWIAOZLDMWDNA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxetanesprimary alcoholspurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholazolen-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundoxacycleorganic oxygen compoundoxetanesecondary alcoholhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|