| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:14 UTC |
|---|
| Update Date | 2025-03-21 18:35:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00106021 |
|---|
| Frequency | 31.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H13NO2S |
|---|
| Molecular Mass | 271.0667 |
|---|
| SMILES | O=C1CSC(c2ccccc2)(c2ccc(O)cc2)N1 |
|---|
| InChI Key | XGQDZJHDJUYFDD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethershydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidesthiazolidines |
|---|
| Substituents | diphenylmethanecarbonyl grouplactamaromatic heteromonocyclic compoundazacycledialkylthioether1-hydroxy-2-unsubstituted benzenoidcarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amideorganic oxideorganic oxygen compoundthioetherorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundthiazolidine |
|---|
