| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:16 UTC |
|---|
| Update Date | 2025-03-21 18:35:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00106086 |
|---|
| Frequency | 25.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16N4O2S2 |
|---|
| Molecular Mass | 312.0715 |
|---|
| SMILES | NC(CCSCc1c[nH]c2ccccc12)=NS(N)(=O)=O |
|---|
| InChI Key | FFJWAEUVAQWSSK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amidinesazacyclic compoundsbenzenoidsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundspyrrolessulfenyl compounds |
|---|
| Substituents | organic sulfuric acid or derivativessulfenyl compoundazacycleindoledialkylthioetherheteroaromatic compoundamidineorganosulfur compoundorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundthioetherpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|
