| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:18:18 UTC |
|---|
| Update Date | 2025-03-21 18:35:32 UTC |
|---|
| HMDB ID | HMDB0029421 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00106186 |
|---|
| Name | N-Acetyldjenkolic acid |
|---|
| Frequency | 25.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N2O5S2 |
|---|
| Molecular Mass | 296.0501 |
|---|
| SMILES | CC(=O)NC(CSCSCC(N)C(=O)O)C(=O)O |
|---|
| InChI Key | KXLLUVVNYPFZTI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-acyl-alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acetamidesalpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdialkylthioethersdicarboxylic acids and derivativesdithioacetalshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidorganosulfur compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundacetamidesulfenyl compoundn-acyl-alpha-amino aciddialkylthioethercarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundthioethercysteine or derivativesdicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic aminethioacetalorganic nitrogen compoundorganooxygen compound |
|---|
