| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:22 UTC |
|---|
| Update Date | 2025-03-21 18:35:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00106319 |
|---|
| Frequency | 25.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO5 |
|---|
| Molecular Mass | 317.1263 |
|---|
| SMILES | COc1ccc2c3c1OC1C(=O)OCC4C(C2O)N(C)CCC314 |
|---|
| InChI Key | AZJSJHDZYBTCHP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | oxamorphinans |
|---|
| Subclass | oxamorphinans |
|---|
| Direct Parent | oxamorphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalkyl aryl ethersamino acids and derivativesanisolesazacyclic compoundscarbonyl compoundscarboxylic acid esterscoumaransdelta valerolactonesfuransfuropyranshydrocarbon derivativesmonocarboxylic acids and derivativesmorphinansnaphthalenesnaphthopyransorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespiperidinespyranssecondary alcoholstetralinstrialkylamines |
|---|
| Substituents | furantetralinphenol ethercarbonyl groupetheramino acid or derivativesdelta valerolactonealkyl aryl ethercarboxylic acid derivativelactoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxanepiperidinedelta_valerolactonetertiary amineorganoheterocyclic compoundcoumaranalcoholazacycle1,2-aminoalcoholoxamorphinantertiary aliphatic aminefuropyranoxacyclenaphthopyranmonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundpyrananisolecarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
